| MDL | - |
|---|---|
| Molecular Weight | 364.34 |
| Molecular Formula | C18H18F2N2O4 |
| SMILES | CC1=C(CC)C(C(NNC([C@H](O)C2=CC(F)=CC(F)=C2)=O)=O)=CC=C1O |
EMD638683 R-Form is the R-form of EMD638683. EMD638683 is a highly selective SGK1 inhibitor with IC 50 of 3 μM.
SGK1 [1]
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 66.67 mg/mL ( 182.99 mM ; ultrasonic and warming and heat to 60°C)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 2.7447 mL | 13.7234 mL | 27.4469 mL |
| 5 mM | 0.5489 mL | 2.7447 mL | 5.4894 mL |
| 10 mM | 0.2745 mL | 1.3723 mL | 2.7447 mL |