| MDL | - |
|---|---|
| Molecular Weight | 1345.67 |
| Molecular Formula | C73H104N10O14 |
| SMILES | O=C(N[C@@H](C(C)C)C(N[C@@H](CCCNC(N)=O)C(NC1=CC=C(COC(N(C)[C@@H](C(C)C)C(N[C@@H](C(C)C)C(N(C)[C@]([C@@H](C)CC)([H])[C@H](OC)CC(N(CCC2)[C@]2([H])[C@H](OC)[C@@H](C)C(N[C@H](C)[C@H](C3=CC=CC=C3)O)=O)=O)=O)=O)=O)C=C1)=O)=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Fmoc-Val-Cit-PAB-MMAE consists the ADCs linker (Fmoc-Val-Cit-PAB) and potent tubulin inhibitor (MMAE). Fmoc-Val-Cit-PAB-MMAE is a drug-linker conjugate for ADC.
|
Auristatin |
Solid
Room temperature in continental US; may vary elsewhere.
4°C, stored under nitrogen
* The compound is unstable in solutions, freshly prepared is recommended.
DMSO : ≥ 30 mg/mL ( 22.29 mM )
* "≥" means soluble, but saturation unknown.
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 0.7431 mL | 3.7156 mL | 7.4312 mL |
| 5 mM | 0.1486 mL | 0.7431 mL | 1.4862 mL |
| 10 mM | 0.0743 mL | 0.3716 mL | 0.7431 mL |