| MDL | - |
|---|---|
| Molecular Weight | 301.42 |
| Molecular Formula | C19H27NO2 |
| SMILES | O=C1O[C@H](CCC2=CC=CN=C2)[C@H]1CCCCCCCC=C |
(3R,4R)-A2-32-01 (compound 24(R,R)), the (R,R)-enantiomer of A2-32-01, is a Staphylococcus aureus caseinolytic protease (SaClpP) inhibitor [1] .
Liquid
Room temperature in continental US; may vary elsewhere.
| Pure form | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 200 mg/mL ( 663.53 mM ; Need ultrasonic)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 3.3176 mL | 16.5882 mL | 33.1763 mL |
| 5 mM | 0.6635 mL | 3.3176 mL | 6.6353 mL |
| 10 mM | 0.3318 mL | 1.6588 mL | 3.3176 mL |