| MDL | - |
|---|---|
| Molecular Weight | 372.34 |
| Molecular Formula | C16H19F3N4O3 |
| SMILES | N#CC1=C(C(F)(F)F)C=C(N2C[C@H](O)[C@@H](O)C2)N=C1N3CC[C@](C)(O)C3 |
KHK-IN-2 is a potent and selective ketohexokinase (KHK) inhibitor with an IC 50 of 0.45 μM.
IC50: 0.45 μM (KHK) [1]
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 250 mg/mL ( 671.43 mM ; Need ultrasonic)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 2.6857 mL | 13.4286 mL | 26.8572 mL |
| 5 mM | 0.5371 mL | 2.6857 mL | 5.3714 mL |
| 10 mM | 0.2686 mL | 1.3429 mL | 2.6857 mL |