| MDL | - |
|---|---|
| Molecular Weight | 454.96 |
| Molecular Formula | C24H32ClFO5 |
| SMILES | C[C@@]12[C@@]3(C(CCl)=O)[C@@](OC(C)(O3)C)([H])C[C@@]1([H])[C@]4([H])CCC5=CC(CC[C@]5(C)[C@@]4(F)[C@@H](O)C2)=O |
Halcinonide (SQ-18566) is a high potency corticosteroid used topically in the treatment of certain skin conditions.
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : ≥ 48 mg/mL ( 105.50 mM )
* "≥" means soluble, but saturation unknown.
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 2.1980 mL | 10.9900 mL | 21.9800 mL |
| 5 mM | 0.4396 mL | 2.1980 mL | 4.3960 mL |
| 10 mM | 0.2198 mL | 1.0990 mL | 2.1980 mL |