| MDL | - |
|---|---|
| Molecular Weight | 940.22 |
| Molecular Formula | C54H77N5O9 |
| SMILES | CC[C@H](C)[C@@H]([C@@H](CC(N1[C@@H](CCC1)[C@@H]([C@@H](C)C(N[C@H](C)[C@@H](O)C2=CC=CC=C2)=O)OC)=O)OC)N(C([C@H](C(C)C)NC([C@H](C(C)C)N(C(OCC3C4=C(C=CC=C4)C5=C3C=CC=C5)=O)C)=O)=O)C |
Fmoc-MMAE is a protective group-conjugated monomethyl auristatin E (MMAE), which is a potent tubulin inhibitor. Fmoc-MMAE can be used in the synthesis of ADC [1] .
|
Auristatin |
Solid
Room temperature in continental US; may vary elsewhere.
4°C, stored under nitrogen
* The compound is unstable in solutions, freshly prepared is recommended.
DMSO : ≥ 45 mg/mL ( 47.86 mM )
* "≥" means soluble, but saturation unknown.
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 1.0636 mL | 5.3179 mL | 10.6358 mL |
| 5 mM | 0.2127 mL | 1.0636 mL | 2.1272 mL |
| 10 mM | 0.1064 mL | 0.5318 mL | 1.0636 mL |