| MDL | - |
|---|---|
| Molecular Weight | 428.65 |
| Molecular Formula | C28H44O3 |
| SMILES | C=C1[C@H](C[C@@H](C/C1=C/C=C2[C@]3([C@@](C)([C@H](CC3)[C@@H](/C=C/[C@@H](C(C)(O)C)C)C)CCC/2)[H])O)O |
Ercalcitriol (1α,25-Dihydroxy Vitamin D2) is an active metabolite of vitamin D2.
|
Human Endogenous Metabolite |
Solid
Room temperature in continental US; may vary elsewhere.
4°C, protect from light, stored under nitrogen
* The compound is unstable in solutions, freshly prepared is recommended.
DMSO : ≥ 50 mg/mL ( 116.65 mM )
* "≥" means soluble, but saturation unknown.
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 2.3329 mL | 11.6645 mL | 23.3291 mL |
| 5 mM | 0.4666 mL | 2.3329 mL | 4.6658 mL |
| 10 mM | 0.2333 mL | 1.1665 mL | 2.3329 mL |