| MDL | - |
|---|---|
| Molecular Weight | 339.39 |
| Molecular Formula | C19H21N3O3 |
| SMILES | CC1CCN(C2=CC=C(C=C2NC(C3=CC=C(C#N)O3)=O)CO)CC1 |
c-Fms-IN-2 is a FMS kinase inhibitor with an IC 50 of 0.024 μM.
c-FMS [1]
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : ≥ 100 mg/mL ( 294.65 mM )
* "≥" means soluble, but saturation unknown.
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 2.9465 mL | 14.7323 mL | 29.4646 mL |
| 5 mM | 0.5893 mL | 2.9465 mL | 5.8929 mL |
| 10 mM | 0.2946 mL | 1.4732 mL | 2.9465 mL |
Add each solvent one by one: 10% DMSO >> 90% corn oil
Solubility: ≥ 2.5 mg/mL (7.37 mM); Clear solution