| MDL | MFCD28400102 |
|---|---|
| Molecular Weight | 766.34 |
| Molecular Formula | C37H52ClN3O10S |
| SMILES | C[C@]12[C@H]([C@@H]([C@](O3)([H])C[C@]([C@](/C=C/C=C(C)/CC4=CC(N(C)C(C[C@]2([H])OC([C@H](C)N(C)C(CCC(S)C)=O)=O)=O)=C(C(OC)=C4)Cl)([H])OC)(NC3=O)O)C)O1 |
DM3 (Maytansinoid DM3) is a maytansine analog bearing disulfide or thiol groups and a tubulin inhibitor, and is a cytotoxic moiety of antibody-drug conjugates (ADCs) [1] .
|
Maytansinoids |
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 100 mg/mL ( 130.49 mM ; ultrasonic and warming and heat to 60°C)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 1.3049 mL | 6.5245 mL | 13.0490 mL |
| 5 mM | 0.2610 mL | 1.3049 mL | 2.6098 mL |
| 10 mM | 0.1305 mL | 0.6525 mL | 1.3049 mL |