| MDL | - |
|---|---|
| Molecular Weight | 483.62 |
| Molecular Formula | C26H33N3O4S |
| SMILES | N#C/C(C1=CC=C(OC)C(OC)=C1)=C\C2=CC=C(N3CCC(OC(CN(CC)CC)=O)CC3)S2 |
YHO-13351 free base is the prodrug of YHO-13177, which is a potent and specific inhibitor of BCRP .
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 100 mg/mL ( 206.77 mM ; Need ultrasonic)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 2.0677 mL | 10.3387 mL | 20.6774 mL |
| 5 mM | 0.4135 mL | 2.0677 mL | 4.1355 mL |
| 10 mM | 0.2068 mL | 1.0339 mL | 2.0677 mL |