| MDL | MFCD11041137 |
|---|---|
| Molecular Weight | 425.39 |
| Molecular Formula | C18H23N3O9 |
| SMILES | O=C(CCOCCOCCNC(CCN1C(C=CC1=O)=O)=O)ON2C(CCC2=O)=O |
Mal-amido-PEG2-NHS ester is a nonclaevable ADC linker containing a maleimide group and an NHS ester. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides , and other amine-containing molecules [1] [2] .
|
Non-cleavable |
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| In solvent | -80°C | 6 months |
| -20°C | 1 month |