| MDL | - |
|---|---|
| Molecular Weight | 422.48 |
| Molecular Formula | C26H22N4O2 |
| SMILES | COC1=CC=C(C2=C(C3=CC=C(OC)C=C3)N=C(CC4=CNC5=C4C=CC=C5)N=N2)C=C1 |
GPR84 antagonist 1 is a high affinity and highly selective competitive antagonist of human GPR84 .
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 50 mg/mL ( 118.35 mM ; Need ultrasonic)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 2.3670 mL | 11.8349 mL | 23.6698 mL |
| 5 mM | 0.4734 mL | 2.3670 mL | 4.7340 mL |
| 10 mM | 0.2367 mL | 1.1835 mL | 2.3670 mL |