| MDL | - |
|---|---|
| Molecular Weight | 229.71 |
| Molecular Formula | C9H16ClN5 |
| SMILES | CCNC1=NC(Cl)=NC(NC(C)(C)C)=N1 |
Terbuthylazine is an inhibitor of acetolactate syntase (ALS), is a selective herbicide.
Solid
Room temperature in continental US; may vary elsewhere.
| Powder | -20°C | 3 years |
|---|---|---|
| 4°C | 2 years | |
| In solvent | -80°C | 6 months |
| -20°C | 1 month |
DMSO : 23 mg/mL ( 100.13 mM ; Need ultrasonic and warming)
| Concentration Solvent Mass | 1 mg | 5 mg | 10 mg |
|---|
| 1 mM | 4.3533 mL | 21.7666 mL | 43.5331 mL |
| 5 mM | 0.8707 mL | 4.3533 mL | 8.7066 mL |
| 10 mM | 0.4353 mL | 2.1767 mL | 4.3533 mL |